Products 2241588-98-5

CAS 2241588-98-5 is the registry number for 2-Bromomethyl-4-chloro-5-methoxy-benzoic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 2-(bromomethyl)-4-chloro-5-methoxybenzoate (CAS 2241588-98-5) is a chemical compound with the molecular formula C10H10BrClO3 and a molecular weight of 293.54 g/mol. IUPAC name: methyl 2-(bromomethyl)-4-chloro-5-methoxybenzoate. InChIKey: ZHIPNHBVPBTDNS-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10BrClO3
Molecular weight293.54 g/mol
IUPAC namemethyl 2-(bromomethyl)-4-chloro-5-methoxybenzoate
InChIKeyZHIPNHBVPBTDNS-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C(=C1)C(=O)OC)CBr)Cl

Computed by PubChem (NCBI)