Products 90844-69-2

CAS 90844-69-2 is the registry number for 2-(2-Bromo-4-chloro-3,5-dimethylphenoxy)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(2-bromo-4-chloro-3,5-dimethylphenoxy)acetic acid (CAS 90844-69-2) is a chemical compound with the molecular formula C10H10BrClO3 and a molecular weight of 293.54 g/mol. IUPAC name: 2-(2-bromo-4-chloro-3,5-dimethylphenoxy)acetic acid. InChIKey: WZVRKVTWSSEPHM-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10BrClO3
Molecular weight293.54 g/mol
IUPAC name2-(2-bromo-4-chloro-3,5-dimethylphenoxy)acetic acid
InChIKeyWZVRKVTWSSEPHM-UHFFFAOYSA-N
SMILESCC1=CC(=C(C(=C1Cl)C)Br)OCC(=O)O

Computed by PubChem (NCBI)