CAS 90844-69-2 is the registry number for 2-(2-Bromo-4-chloro-3,5-dimethylphenoxy)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2-bromo-4-chloro-3,5-dimethylphenoxy)acetic acid (CAS 90844-69-2) is a chemical compound with the molecular formula C10H10BrClO3 and a molecular weight of 293.54 g/mol. IUPAC name: 2-(2-bromo-4-chloro-3,5-dimethylphenoxy)acetic acid. InChIKey: WZVRKVTWSSEPHM-UHFFFAOYSA-N.
| Molecular formula | C10H10BrClO3 |
|---|---|
| Molecular weight | 293.54 g/mol |
| IUPAC name | 2-(2-bromo-4-chloro-3,5-dimethylphenoxy)acetic acid |
| InChIKey | WZVRKVTWSSEPHM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1Cl)C)Br)OCC(=O)O |
Computed by PubChem (NCBI)