Products 1160254-09-0
CAS 1160254-09-0 appears in our catalog under these names: 8-Methyl-2-(2-methylphenyl)quinoline-4-carbonyl chloride, 95%, 8-Methyl-2-(o-tolyl)quinoline-4-carbonyl chloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
8-methyl-2-(2-methylphenyl)quinoline-4-carbonyl chloride (CAS 1160254-09-0) is a chemical compound with the molecular formula C18H14ClNO and a molecular weight of 295.8 g/mol. IUPAC name: 8-methyl-2-(2-methylphenyl)quinoline-4-carbonyl chloride. InChIKey: BBBDZDNXKOSYAG-UHFFFAOYSA-N.
| Molecular formula | C18H14ClNO |
|---|---|
| Molecular weight | 295.8 g/mol |
| IUPAC name | 8-methyl-2-(2-methylphenyl)quinoline-4-carbonyl chloride |
| InChIKey | BBBDZDNXKOSYAG-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=CC(=N2)C3=CC=CC=C3C)C(=O)Cl |
Computed by PubChem (NCBI)