CAS 1160260-75-2 appears in our catalog under these names: 7,8-Dimethyl-2-phenylquinoline-4-carbonyl chloride, 95%, 7,8-Dimethyl-2-phenylquinoline-4-carbonyl chloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
7,8-dimethyl-2-phenylquinoline-4-carbonyl chloride (CAS 1160260-75-2) is a chemical compound with the molecular formula C18H14ClNO and a molecular weight of 295.8 g/mol. IUPAC name: 7,8-dimethyl-2-phenylquinoline-4-carbonyl chloride. InChIKey: GREBLKMRSGYHQQ-UHFFFAOYSA-N.
| Molecular formula | C18H14ClNO |
|---|---|
| Molecular weight | 295.8 g/mol |
| IUPAC name | 7,8-dimethyl-2-phenylquinoline-4-carbonyl chloride |
| InChIKey | GREBLKMRSGYHQQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)C(=CC(=N2)C3=CC=CC=C3)C(=O)Cl)C |
Computed by PubChem (NCBI)