Products 1160264-71-0

CAS 1160264-71-0 appears in our catalog under these names: 2-(3,4-Dimethylphenyl)quinoline-4-carbonyl chloride, 95%, 2-(3,4-Dimethylphenyl)quinoline-4-carbonyl chloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(3,4-dimethylphenyl)quinoline-4-carbonyl chloride (CAS 1160264-71-0) is a chemical compound with the molecular formula C18H14ClNO and a molecular weight of 295.8 g/mol. IUPAC name: 2-(3,4-dimethylphenyl)quinoline-4-carbonyl chloride. InChIKey: LZRISFCHGXWGFP-UHFFFAOYSA-N.

Identity
Molecular formulaC18H14ClNO
Molecular weight295.8 g/mol
IUPAC name2-(3,4-dimethylphenyl)quinoline-4-carbonyl chloride
InChIKeyLZRISFCHGXWGFP-UHFFFAOYSA-N
SMILESCC1=C(C=C(C=C1)C2=NC3=CC=CC=C3C(=C2)C(=O)Cl)C

Computed by PubChem (NCBI)