CAS 1160257-14-6 appears in our catalog under these names: 6-Ethyl-2-(2-thienyl)quinoline-4-carbonyl chloride, 95%, 6-Ethyl-2-(thiophen-2-yl)quinoline-4-carbonyl chloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
6-ethyl-2-thiophen-2-ylquinoline-4-carbonyl chloride (CAS 1160257-14-6) is a chemical compound with the molecular formula C16H12ClNOS and a molecular weight of 301.8 g/mol. IUPAC name: 6-ethyl-2-thiophen-2-ylquinoline-4-carbonyl chloride. InChIKey: FVCCQQVZWYJFGG-UHFFFAOYSA-N.
| Molecular formula | C16H12ClNOS |
|---|---|
| Molecular weight | 301.8 g/mol |
| IUPAC name | 6-ethyl-2-thiophen-2-ylquinoline-4-carbonyl chloride |
| InChIKey | FVCCQQVZWYJFGG-UHFFFAOYSA-N |
| SMILES | CCC1=CC2=C(C=C1)N=C(C=C2C(=O)Cl)C3=CC=CS3 |
Computed by PubChem (NCBI)