CAS 262376-75-0 is the registry number for HMR1426. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-chloro-2-phenyl-3a,4-dihydroindeno[1,2-d][1,3]thiazol-8b-ol (CAS 262376-75-0) is a chemical compound with the molecular formula C16H12ClNOS and a molecular weight of 301.8 g/mol. IUPAC name: 6-chloro-2-phenyl-3a,4-dihydroindeno[1,2-d][1,3]thiazol-8b-ol. InChIKey: RUBKYBIDEVUTQU-UHFFFAOYSA-N.
| Molecular formula | C16H12ClNOS |
|---|---|
| Molecular weight | 301.8 g/mol |
| IUPAC name | 6-chloro-2-phenyl-3a,4-dihydroindeno[1,2-d][1,3]thiazol-8b-ol |
| InChIKey | RUBKYBIDEVUTQU-UHFFFAOYSA-N |
| SMILES | C1C2C(C3=C1C=C(C=C3)Cl)(N=C(S2)C4=CC=CC=C4)O |
Computed by PubChem (NCBI)