Products 1443377-62-5
CAS 1443377-62-5 is the registry number for 6-(Benzylthio)-1-chloroisoquinolin-4-ol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-benzylsulfanyl-1-chloroisoquinolin-4-ol (CAS 1443377-62-5) is a chemical compound with the molecular formula C16H12ClNOS and a molecular weight of 301.8 g/mol. IUPAC name: 6-benzylsulfanyl-1-chloroisoquinolin-4-ol. InChIKey: HWBULDQAYUTXDT-UHFFFAOYSA-N.
| Molecular formula | C16H12ClNOS |
|---|---|
| Molecular weight | 301.8 g/mol |
| IUPAC name | 6-benzylsulfanyl-1-chloroisoquinolin-4-ol |
| InChIKey | HWBULDQAYUTXDT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CSC2=CC3=C(C=C2)C(=NC=C3O)Cl |
Computed by PubChem (NCBI)