CAS 116046-53-8 appears in our catalog under these names: Ethyl 3-oxo-2-(trifluoromethyl)butanoate, 95%, Ethyl 3-oxo-2-(trifluoromethyl)butanoate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 50mg, 0,5g.
Ethyl 3-oxo-2-(trifluoromethyl)butanoate (CAS 116046-53-8) is a chemical compound with the molecular formula C7H9F3O3 and a molecular weight of 198.14 g/mol. IUPAC name: ethyl 3-oxo-2-(trifluoromethyl)butanoate. InChIKey: AQRYRSMBPVPPMZ-UHFFFAOYSA-N.
| Molecular formula | C7H9F3O3 |
|---|---|
| Molecular weight | 198.14 g/mol |
| IUPAC name | ethyl 3-oxo-2-(trifluoromethyl)butanoate |
| InChIKey | AQRYRSMBPVPPMZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C(=O)C)C(F)(F)F |
Computed by PubChem (NCBI)