CAS 175230-50-9 appears in our catalog under these names: Isopropyl 4,4,4-trifluoroacetoacetate, 95%, Isopropyl 4,4,4-trifluoro-3-oxobutanoate, 98%, Isopropyl 4,4,4–Trifluoroacetoacetate, Isopropyl 4,4,4-trifluoro-3-oxobutanoate. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 25g, 5g, 1g.
Propan-2-yl 4,4,4-trifluoro-3-oxobutanoate (CAS 175230-50-9) is a chemical compound with the molecular formula C7H9F3O3 and a molecular weight of 198.14 g/mol. IUPAC name: propan-2-yl 4,4,4-trifluoro-3-oxobutanoate. InChIKey: XLBGYZLICFMDDS-UHFFFAOYSA-N.
| Molecular formula | C7H9F3O3 |
|---|---|
| Molecular weight | 198.14 g/mol |
| IUPAC name | propan-2-yl 4,4,4-trifluoro-3-oxobutanoate |
| InChIKey | XLBGYZLICFMDDS-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)CC(=O)C(F)(F)F |
Computed by PubChem (NCBI)