CAS 126953-88-6 is the registry number for Dihydro-3-hydroxy-5,5-dimethyl-3-(trifluoromethyl)-2(3h)-furanone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3-hydroxy-5,5-dimethyl-3-(trifluoromethyl)oxolan-2-one (CAS 126953-88-6) is a chemical compound with the molecular formula C7H9F3O3 and a molecular weight of 198.14 g/mol. IUPAC name: 3-hydroxy-5,5-dimethyl-3-(trifluoromethyl)oxolan-2-one. InChIKey: MLXTZSCAFBJBMG-UHFFFAOYSA-N.
| Molecular formula | C7H9F3O3 |
|---|---|
| Molecular weight | 198.14 g/mol |
| IUPAC name | 3-hydroxy-5,5-dimethyl-3-(trifluoromethyl)oxolan-2-one |
| InChIKey | MLXTZSCAFBJBMG-UHFFFAOYSA-N |
| SMILES | CC1(CC(C(=O)O1)(C(F)(F)F)O)C |
Computed by PubChem (NCBI)