CAS 1160474-70-3 is the registry number for [2,3-Dichloro-5-(trifluoromethyl)-4-pyridinyl]methanol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
[2,3-dichloro-5-(trifluoromethyl)-4-pyridinyl]methanol (CAS 1160474-70-3) is a chemical compound with the molecular formula C7H4Cl2F3NO and a molecular weight of 246.01 g/mol. IUPAC name: [2,3-dichloro-5-(trifluoromethyl)-4-pyridinyl]methanol. InChIKey: KPKSXPWHKRAFSF-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2F3NO |
|---|---|
| Molecular weight | 246.01 g/mol |
| IUPAC name | [2,3-dichloro-5-(trifluoromethyl)-4-pyridinyl]methanol |
| InChIKey | KPKSXPWHKRAFSF-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=N1)Cl)Cl)CO)C(F)(F)F |
Computed by PubChem (NCBI)