CAS 1823358-80-0 appears in our catalog under these names: 1-(2,6-Dichloropyridin-3-yl)-2,2,2-trifluoroethanol, 95%, 1-(2,6-Dichloropyridin-3-yl)-2,2,2-trifluoroethanol. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
1-(2,6-dichloro-3-pyridinyl)-2,2,2-trifluoroethanol (CAS 1823358-80-0) is a chemical compound with the molecular formula C7H4Cl2F3NO and a molecular weight of 246.01 g/mol. IUPAC name: 1-(2,6-dichloro-3-pyridinyl)-2,2,2-trifluoroethanol. InChIKey: DVHXXVXPKOYEAM-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2F3NO |
|---|---|
| Molecular weight | 246.01 g/mol |
| IUPAC name | 1-(2,6-dichloro-3-pyridinyl)-2,2,2-trifluoroethanol |
| InChIKey | DVHXXVXPKOYEAM-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1C(C(F)(F)F)O)Cl)Cl |
Computed by PubChem (NCBI)