CAS 2228378-85-4 is the registry number for 1-(3,5-Dichloropyridin-4-yl)-2,2,2-trifluoroethan-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(3,5-dichloro-4-pyridinyl)-2,2,2-trifluoroethanol (CAS 2228378-85-4) is a chemical compound with the molecular formula C7H4Cl2F3NO and a molecular weight of 246.01 g/mol. IUPAC name: 1-(3,5-dichloro-4-pyridinyl)-2,2,2-trifluoroethanol. InChIKey: MMYPVCBSTALUJD-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2F3NO |
|---|---|
| Molecular weight | 246.01 g/mol |
| IUPAC name | 1-(3,5-dichloro-4-pyridinyl)-2,2,2-trifluoroethanol |
| InChIKey | MMYPVCBSTALUJD-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C=N1)Cl)C(C(F)(F)F)O)Cl |
Computed by PubChem (NCBI)