CAS 116070-38-3 is the registry number for 3-Methyl-5-(trifluoromethyl)benzyl alcohol, 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
[3-methyl-5-(trifluoromethyl)phenyl]methanol (CAS 116070-38-3) is a chemical compound with the molecular formula C9H9F3O and a molecular weight of 190.16 g/mol. IUPAC name: [3-methyl-5-(trifluoromethyl)phenyl]methanol. InChIKey: ZGZONWVUWCPMJZ-UHFFFAOYSA-N.
| Molecular formula | C9H9F3O |
|---|---|
| Molecular weight | 190.16 g/mol |
| IUPAC name | [3-methyl-5-(trifluoromethyl)phenyl]methanol |
| InChIKey | ZGZONWVUWCPMJZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C(F)(F)F)CO |
Computed by PubChem (NCBI)