CAS 426-54-0 appears in our catalog under these names: 2-Phenyl-1,1,1-trifluoropropan-2-ol, 95%, 1,1,1-Trifluoro-2-phenylpropan-2-ol, 95+%, 2-Phenyl-1,1,1-trifluoropropan-2-ol, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 25g, 5g, 250mg.
1,1,1-trifluoro-2-phenylpropan-2-ol (CAS 426-54-0) is a chemical compound with the molecular formula C9H9F3O and a molecular weight of 190.16 g/mol. IUPAC name: 1,1,1-trifluoro-2-phenylpropan-2-ol. InChIKey: HYUUEULUXBVXSG-UHFFFAOYSA-N.
| Molecular formula | C9H9F3O |
|---|---|
| Molecular weight | 190.16 g/mol |
| IUPAC name | 1,1,1-trifluoro-2-phenylpropan-2-ol |
| InChIKey | HYUUEULUXBVXSG-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC=C1)(C(F)(F)F)O |
Computed by PubChem (NCBI)