CAS 886502-81-4 appears in our catalog under these names: 5-Methyl-2-(trifluoromethyl)benzyl alcohol, 95%, 5-Methyl-2-(trifluoromethyl)benzyl alcohol. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 10g.
[5-methyl-2-(trifluoromethyl)phenyl]methanol (CAS 886502-81-4) is a chemical compound with the molecular formula C9H9F3O and a molecular weight of 190.16 g/mol. IUPAC name: [5-methyl-2-(trifluoromethyl)phenyl]methanol. InChIKey: WZMOLCCNJJHAJQ-UHFFFAOYSA-N.
| Molecular formula | C9H9F3O |
|---|---|
| Molecular weight | 190.16 g/mol |
| IUPAC name | [5-methyl-2-(trifluoromethyl)phenyl]methanol |
| InChIKey | WZMOLCCNJJHAJQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C(F)(F)F)CO |
Computed by PubChem (NCBI)