CAS 1160725-33-6 appears in our catalog under these names: Potassium (4-ethylphenyl)trifluoroboranuide, 95%, Potassium (4–ethylphenyl)trifluoroboranuide. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 1g.
Potassium (4-ethylphenyl)-trifluoroboranuide (CAS 1160725-33-6) is a chemical compound with the molecular formula C8H9BF3K and a molecular weight of 212.06 g/mol. IUPAC name: potassium (4-ethylphenyl)-trifluoroboranuide. InChIKey: KFIINFZVJLVXSQ-UHFFFAOYSA-N.
| Molecular formula | C8H9BF3K |
|---|---|
| Molecular weight | 212.06 g/mol |
| IUPAC name | potassium (4-ethylphenyl)-trifluoroboranuide |
| InChIKey | KFIINFZVJLVXSQ-UHFFFAOYSA-N |
| SMILES | [B-](C1=CC=C(C=C1)CC)(F)(F)F.[K+] |
Computed by PubChem (NCBI)