CAS 329976-80-9 is the registry number for Potassium trifluoro(1-phenylethyl)borate, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
Potassium trifluoro(1-phenylethyl)boranuide (CAS 329976-80-9) is a chemical compound with the molecular formula C8H9BF3K and a molecular weight of 212.06 g/mol. IUPAC name: potassium trifluoro(1-phenylethyl)boranuide. InChIKey: FQDLGAXXPXNHJV-UHFFFAOYSA-N.
| Molecular formula | C8H9BF3K |
|---|---|
| Molecular weight | 212.06 g/mol |
| IUPAC name | potassium trifluoro(1-phenylethyl)boranuide |
| InChIKey | FQDLGAXXPXNHJV-UHFFFAOYSA-N |
| SMILES | [B-](C(C)C1=CC=CC=C1)(F)(F)F.[K+] |
Computed by PubChem (NCBI)