CAS 561328-67-4 appears in our catalog under these names: Potassium (2,6-dimethylphenyl)trifluoroborate 97%, Potassium (2,6-dimethylphenyl)trifluoroborate, 97%, 97%. Offered by: Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g.
Potassium (2,6-dimethylphenyl)-trifluoroboranuide (CAS 561328-67-4) is a chemical compound with the molecular formula C8H9BF3K and a molecular weight of 212.06 g/mol. IUPAC name: potassium (2,6-dimethylphenyl)-trifluoroboranuide. InChIKey: IPLMJMPCMNNZAZ-UHFFFAOYSA-N.
| Molecular formula | C8H9BF3K |
|---|---|
| Molecular weight | 212.06 g/mol |
| IUPAC name | potassium (2,6-dimethylphenyl)-trifluoroboranuide |
| InChIKey | IPLMJMPCMNNZAZ-UHFFFAOYSA-N |
| SMILES | [B-](C1=C(C=CC=C1C)C)(F)(F)F.[K+] |
Computed by PubChem (NCBI)