CAS 116081-73-3 appears in our catalog under these names: 4–Aminoindoline–2,3–dione, 4-Aminoindoline-2,3-dione, 98%, 98%, 4-Aminoindoline-2,3-dione, 98%, 4-Aminoindoline-2,3-dione, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
4-amino-1H-indole-2,3-dione (CAS 116081-73-3) is a chemical compound with the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. IUPAC name: 4-amino-1H-indole-2,3-dione. InChIKey: MQRCEPSCJLYNKO-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 4-amino-1H-indole-2,3-dione |
| InChIKey | MQRCEPSCJLYNKO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)NC(=O)C2=O)N |
Computed by PubChem (NCBI)