CAS 116081-74-4 appears in our catalog under these names: 6-Amino Isatin, 6-Aminoindoline-2,3-dione, 95%, 95%. Offered by: TRC, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
6-amino-1H-indole-2,3-dione (CAS 116081-74-4) is a chemical compound with the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. IUPAC name: 6-amino-1H-indole-2,3-dione. InChIKey: NAZUFMFAUQMVSJ-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 6-amino-1H-indole-2,3-dione |
| InChIKey | NAZUFMFAUQMVSJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1N)NC(=O)C2=O |
Computed by PubChem (NCBI)