CAS 1160952-43-1 is the registry number for KU-177. Offered by: MedChemExpress. Available pack sizes: 10 mg, 25 mg, 5 mg, 1 mg.
[8-methoxy-3-[[4-methoxy-3-(3-methoxyphenyl)benzoyl]amino]-2-oxochromen-7-yl] acetate (CAS 1160952-43-1) is a chemical compound with the molecular formula C27H23NO8 and a molecular weight of 489.5 g/mol. IUPAC name: [8-methoxy-3-[[4-methoxy-3-(3-methoxyphenyl)benzoyl]amino]-2-oxochromen-7-yl] acetate. InChIKey: DKZHANZAVOELPJ-UHFFFAOYSA-N.
| Molecular formula | C27H23NO8 |
|---|---|
| Molecular weight | 489.5 g/mol |
| IUPAC name | [8-methoxy-3-[[4-methoxy-3-(3-methoxyphenyl)benzoyl]amino]-2-oxochromen-7-yl] acetate |
| InChIKey | DKZHANZAVOELPJ-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(C2=C(C=C1)C=C(C(=O)O2)NC(=O)C3=CC(=C(C=C3)OC)C4=CC(=CC=C4)OC)OC |
Computed by PubChem (NCBI)