Products 1160952-43-1

CAS 1160952-43-1 is the registry number for KU-177. Offered by: MedChemExpress. Available pack sizes: 10 mg, 25 mg, 5 mg, 1 mg.

Structural formula: {0} (CAS {1})

[8-methoxy-3-[[4-methoxy-3-(3-methoxyphenyl)benzoyl]amino]-2-oxochromen-7-yl] acetate (CAS 1160952-43-1) is a chemical compound with the molecular formula C27H23NO8 and a molecular weight of 489.5 g/mol. IUPAC name: [8-methoxy-3-[[4-methoxy-3-(3-methoxyphenyl)benzoyl]amino]-2-oxochromen-7-yl] acetate. InChIKey: DKZHANZAVOELPJ-UHFFFAOYSA-N.

Identity
Molecular formulaC27H23NO8
Molecular weight489.5 g/mol
IUPAC name[8-methoxy-3-[[4-methoxy-3-(3-methoxyphenyl)benzoyl]amino]-2-oxochromen-7-yl] acetate
InChIKeyDKZHANZAVOELPJ-UHFFFAOYSA-N
SMILESCC(=O)OC1=C(C2=C(C=C1)C=C(C(=O)O2)NC(=O)C3=CC(=C(C=C3)OC)C4=CC(=CC=C4)OC)OC

Computed by PubChem (NCBI)

Synonyms: orb1686769