Products 323196-16-3
CAS 323196-16-3 is the registry number for 6-(Fluorescein-6-carboxamido)hexanoic acid. Offered by: Chemat. Available pack sizes: 10mg, 50mg.
6-[(3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carbonyl)amino]hexanoic acid (CAS 323196-16-3) is a chemical compound with the molecular formula C27H23NO8 and a molecular weight of 489.5 g/mol. IUPAC name: 6-[(3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carbonyl)amino]hexanoic acid. InChIKey: FTWQNFDVCXCPGQ-UHFFFAOYSA-N.
| Molecular formula | C27H23NO8 |
|---|---|
| Molecular weight | 489.5 g/mol |
| IUPAC name | 6-[(3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carbonyl)amino]hexanoic acid |
| InChIKey | FTWQNFDVCXCPGQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)NCCCCCC(=O)O)C3(C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O)OC2=O |
Computed by PubChem (NCBI)