Products 194661-60-4
CAS 194661-60-4 is the registry number for 6-(Fluorescein-5-carboxamido)hexanoic Acid. Offered by: TRC, Chemat. Available pack sizes: 100mg, 10mg, 50mg.
6-[(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carbonyl)amino]hexanoic acid (CAS 194661-60-4) is a chemical compound with the molecular formula C27H23NO8 and a molecular weight of 489.5 g/mol. IUPAC name: 6-[(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carbonyl)amino]hexanoic acid. InChIKey: ZCQBPACVENBWSF-UHFFFAOYSA-N.
| Molecular formula | C27H23NO8 |
|---|---|
| Molecular weight | 489.5 g/mol |
| IUPAC name | 6-[(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carbonyl)amino]hexanoic acid |
| InChIKey | ZCQBPACVENBWSF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)NCCCCCC(=O)O)C(=O)OC23C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O |
Computed by PubChem (NCBI)