CAS 1160994-15-9 is the registry number for 4-Chloro-6-methyl-7-(trifluoromethyl)quinazoline, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
4-chloro-6-methyl-7-(trifluoromethyl)quinazoline (CAS 1160994-15-9) is a chemical compound with the molecular formula C10H6ClF3N2 and a molecular weight of 246.61 g/mol. IUPAC name: 4-chloro-6-methyl-7-(trifluoromethyl)quinazoline. InChIKey: DZWRZIJRHGZOKG-UHFFFAOYSA-N.
| Molecular formula | C10H6ClF3N2 |
|---|---|
| Molecular weight | 246.61 g/mol |
| IUPAC name | 4-chloro-6-methyl-7-(trifluoromethyl)quinazoline |
| InChIKey | DZWRZIJRHGZOKG-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1C(F)(F)F)N=CN=C2Cl |
Computed by PubChem (NCBI)