CAS 2102553-43-3 is the registry number for 4-Chloro-6-(2,2,2-trifluoroethyl)quinazoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-6-(2,2,2-trifluoroethyl)quinazoline (CAS 2102553-43-3) is a chemical compound with the molecular formula C10H6ClF3N2 and a molecular weight of 246.61 g/mol. IUPAC name: 4-chloro-6-(2,2,2-trifluoroethyl)quinazoline. InChIKey: ZEZGMJMDMNNKSN-UHFFFAOYSA-N.
| Molecular formula | C10H6ClF3N2 |
|---|---|
| Molecular weight | 246.61 g/mol |
| IUPAC name | 4-chloro-6-(2,2,2-trifluoroethyl)quinazoline |
| InChIKey | ZEZGMJMDMNNKSN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1CC(F)(F)F)C(=NC=N2)Cl |
Computed by PubChem (NCBI)