CAS 235106-13-5 is the registry number for 4-Chloro-3-(trifluoromethyl)-5-(phenyl)pyrazole, 97%. Offered by: Fluorochem. Available pack sizes: 1g.
4-chloro-3-phenyl-5-(trifluoromethyl)-1H-pyrazole (CAS 235106-13-5) is a chemical compound with the molecular formula C10H6ClF3N2 and a molecular weight of 246.61 g/mol. IUPAC name: 4-chloro-3-phenyl-5-(trifluoromethyl)-1H-pyrazole. InChIKey: RJIXEBOSMSSXJC-UHFFFAOYSA-N.
| Molecular formula | C10H6ClF3N2 |
|---|---|
| Molecular weight | 246.61 g/mol |
| IUPAC name | 4-chloro-3-phenyl-5-(trifluoromethyl)-1H-pyrazole |
| InChIKey | RJIXEBOSMSSXJC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NNC(=C2Cl)C(F)(F)F |
Computed by PubChem (NCBI)