Products 1161177-06-5
CAS 1161177-06-5 is the registry number for N3-Methyl-4-(phenylsulfonyl)-1H-pyrazole-3,5-diamine, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(benzenesulfonyl)-3-N-methyl-1H-pyrazole-3,5-diamine (CAS 1161177-06-5) is a chemical compound with the molecular formula C10H12N4O2S and a molecular weight of 252.30 g/mol. IUPAC name: 4-(benzenesulfonyl)-3-N-methyl-1H-pyrazole-3,5-diamine. InChIKey: YXVOUPHTWMCEDO-UHFFFAOYSA-N.
| Molecular formula | C10H12N4O2S |
|---|---|
| Molecular weight | 252.30 g/mol |
| IUPAC name | 4-(benzenesulfonyl)-3-N-methyl-1H-pyrazole-3,5-diamine |
| InChIKey | YXVOUPHTWMCEDO-UHFFFAOYSA-N |
| SMILES | CNC1=NNC(=C1S(=O)(=O)C2=CC=CC=C2)N |
Computed by PubChem (NCBI)