Products 1895258-71-5

CAS 1895258-71-5 is the registry number for 2-(1H-[1,2,3]Triazolo[4,5-c]pyridin-1-yl)tetrahydro-2H-thiopyran 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-(triazolo[4,5-c]pyridin-1-yl)thiane 1,1-dioxide (CAS 1895258-71-5) is a chemical compound with the molecular formula C10H12N4O2S and a molecular weight of 252.30 g/mol. IUPAC name: 2-(triazolo[4,5-c]pyridin-1-yl)thiane 1,1-dioxide. InChIKey: BOIWKFSKXWUBKD-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12N4O2S
Molecular weight252.30 g/mol
IUPAC name2-(triazolo[4,5-c]pyridin-1-yl)thiane 1,1-dioxide
InChIKeyBOIWKFSKXWUBKD-UHFFFAOYSA-N
SMILESC1CCS(=O)(=O)C(C1)N2C3=C(C=NC=C3)N=N2

Computed by PubChem (NCBI)