CAS 618913-30-7 appears in our catalog under these names: Azd5904, 95%, AZD5904/ 99.7% (existing batch purity), AZD5904, AZD5904 98%, (R)-3-((Tetrahydrofuran-2-yl)methyl)-2-thioxo-1,2,3,9-tetrahydro-6H-purin-6-one. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 250mg, 100mg, 1mg, 5mg, 10mg, 25mg, 50mg, 200mg.
3-[[(2R)-oxolan-2-yl]methyl]-2-sulfanylidene-7H-purin-6-one (CAS 618913-30-7) is a chemical compound with the molecular formula C10H12N4O2S and a molecular weight of 252.30 g/mol. IUPAC name: 3-[[(2R)-oxolan-2-yl]methyl]-2-sulfanylidene-7H-purin-6-one. InChIKey: RSPDBEVKURKEII-ZCFIWIBFSA-N.
| Molecular formula | C10H12N4O2S |
|---|---|
| Molecular weight | 252.30 g/mol |
| IUPAC name | 3-[[(2R)-oxolan-2-yl]methyl]-2-sulfanylidene-7H-purin-6-one |
| InChIKey | RSPDBEVKURKEII-ZCFIWIBFSA-N |
| SMILES | C1C[C@@H](OC1)CN2C3=C(C(=O)NC2=S)NC=N3 |
Computed by PubChem (NCBI)