Products 1161771-91-0
CAS 1161771-91-0 is the registry number for tert-Butyl (2S,5R)-2-ethyl-5-methylpiperazine-1-carboxylate oxalate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (2S,5R)-2-ethyl-5-methylpiperazine-1-carboxylate;oxalic acid (CAS 1161771-91-0) is a chemical compound with the molecular formula C14H26N2O6 and a molecular weight of 318.37 g/mol. IUPAC name: tert-butyl (2S,5R)-2-ethyl-5-methylpiperazine-1-carboxylate;oxalic acid. InChIKey: USVSWDOJKMLGRM-UXQCFNEQSA-N.
| Molecular formula | C14H26N2O6 |
|---|---|
| Molecular weight | 318.37 g/mol |
| IUPAC name | tert-butyl (2S,5R)-2-ethyl-5-methylpiperazine-1-carboxylate;oxalic acid |
| InChIKey | USVSWDOJKMLGRM-UXQCFNEQSA-N |
| SMILES | CC[C@H]1CN[C@@H](CN1C(=O)OC(C)(C)C)C.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)