Products 887610-86-8
CAS 887610-86-8 is the registry number for (S)-tert-Butyl 2-((tert-butoxycarbonyl)amino)-5-nitropentanoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-nitropentanoate (CAS 887610-86-8) is a chemical compound with the molecular formula C14H26N2O6 and a molecular weight of 318.37 g/mol. IUPAC name: tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-nitropentanoate. InChIKey: GTZPWXOLLLSOOT-JTQLQIEISA-N.
| Molecular formula | C14H26N2O6 |
|---|---|
| Molecular weight | 318.37 g/mol |
| IUPAC name | tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-nitropentanoate |
| InChIKey | GTZPWXOLLLSOOT-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](CCC[N+](=O)[O-])NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)