CAS 34404-27-8 is the registry number for (2S)-2,4-Bis(tert-butoxycarbonylamino)butanoic acid. Offered by: Biosynth. Available pack sizes: 10g, 1g.
(2S)-2,4-bis[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 34404-27-8) is a chemical compound with the molecular formula C14H26N2O6 and a molecular weight of 318.37 g/mol. IUPAC name: (2S)-2,4-bis[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: JIYZOHCBABALOE-VIFPVBQESA-N.
| Molecular formula | C14H26N2O6 |
|---|---|
| Molecular weight | 318.37 g/mol |
| IUPAC name | (2S)-2,4-bis[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | JIYZOHCBABALOE-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)NCC[C@@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)