CAS 116233-13-7 is the registry number for 3,4-Diisopropylaniline, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3,4-di(propan-2-yl)aniline (CAS 116233-13-7) is a chemical compound with the molecular formula C12H19N and a molecular weight of 177.29 g/mol. IUPAC name: 3,4-di(propan-2-yl)aniline. InChIKey: YQBCQWYZOXZDAI-UHFFFAOYSA-N.
| Molecular formula | C12H19N |
|---|---|
| Molecular weight | 177.29 g/mol |
| IUPAC name | 3,4-di(propan-2-yl)aniline |
| InChIKey | YQBCQWYZOXZDAI-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C=C(C=C1)N)C(C)C |
Computed by PubChem (NCBI)