CAS 116275-39-9 appears in our catalog under these names: N-Benzyl 4-chloropicolinamide, 98%, N-Benzyl-4-chloropyridine-2-carboxamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 1g, 25g, 5g, 2,5g.
N-benzyl-4-chloropyridine-2-carboxamide (CAS 116275-39-9) is a chemical compound with the molecular formula C13H11ClN2O and a molecular weight of 246.69 g/mol. IUPAC name: N-benzyl-4-chloropyridine-2-carboxamide. InChIKey: XNKYZWCVSFIEPN-UHFFFAOYSA-N.
| Molecular formula | C13H11ClN2O |
|---|---|
| Molecular weight | 246.69 g/mol |
| IUPAC name | N-benzyl-4-chloropyridine-2-carboxamide |
| InChIKey | XNKYZWCVSFIEPN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC(=O)C2=NC=CC(=C2)Cl |
Computed by PubChem (NCBI)