CAS 1173631-52-1 appears in our catalog under these names: 4-Chloro-5-methyl-2-[(e)-phenyldiazenyl]phenol, 95%, 4-CHloro-5-methyl-2-((e)-phenyldiazenyl)phenol, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
4-chloro-5-methyl-2-phenyldiazenylphenol (CAS 1173631-52-1) is a chemical compound with the molecular formula C13H11ClN2O and a molecular weight of 246.69 g/mol. IUPAC name: 4-chloro-5-methyl-2-phenyldiazenylphenol. InChIKey: PLZWRFMDTAUQNH-UHFFFAOYSA-N.
| Molecular formula | C13H11ClN2O |
|---|---|
| Molecular weight | 246.69 g/mol |
| IUPAC name | 4-chloro-5-methyl-2-phenyldiazenylphenol |
| InChIKey | PLZWRFMDTAUQNH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Cl)N=NC2=CC=CC=C2)O |
Computed by PubChem (NCBI)