CAS 905811-04-3 appears in our catalog under these names: N-(3-Aminophenyl)-4-chlorobenzamide, 95%, N-(3-Aminophenyl)-4-chlorobenzamide 95+%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 1g, 5g, 250mg.
N-(3-aminophenyl)-4-chlorobenzamide (CAS 905811-04-3) is a chemical compound with the molecular formula C13H11ClN2O and a molecular weight of 246.69 g/mol. IUPAC name: N-(3-aminophenyl)-4-chlorobenzamide. InChIKey: RCPUMSGSCKNPRZ-UHFFFAOYSA-N.
| Molecular formula | C13H11ClN2O |
|---|---|
| Molecular weight | 246.69 g/mol |
| IUPAC name | N-(3-aminophenyl)-4-chlorobenzamide |
| InChIKey | RCPUMSGSCKNPRZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)NC(=O)C2=CC=C(C=C2)Cl)N |
Computed by PubChem (NCBI)