CAS 1163258-83-0 appears in our catalog under these names: 4-Chloro-3,5-difluorocinnamic acid, 95%, 3-(4-Chloro-3,5-difluorophenyl)acrylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
(E)-3-(4-chloro-3,5-difluorophenyl)prop-2-enoic acid (CAS 1163258-83-0) is a chemical compound with the molecular formula C9H5ClF2O2 and a molecular weight of 218.58 g/mol. IUPAC name: (E)-3-(4-chloro-3,5-difluorophenyl)prop-2-enoic acid. InChIKey: XWQMRFBOVAOGAA-OWOJBTEDSA-N.
| Molecular formula | C9H5ClF2O2 |
|---|---|
| Molecular weight | 218.58 g/mol |
| IUPAC name | (E)-3-(4-chloro-3,5-difluorophenyl)prop-2-enoic acid |
| InChIKey | XWQMRFBOVAOGAA-OWOJBTEDSA-N |
| SMILES | C1=C(C=C(C(=C1F)Cl)F)/C=C/C(=O)O |
Computed by PubChem (NCBI)