Products 695187-30-5

CAS 695187-30-5 is the registry number for 5-Chloro-2,4-difluorocinnamic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.

Structural formula: {0} (CAS {1})

(E)-3-(5-chloro-2,4-difluorophenyl)prop-2-enoic acid (CAS 695187-30-5) is a chemical compound with the molecular formula C9H5ClF2O2 and a molecular weight of 218.58 g/mol. IUPAC name: (E)-3-(5-chloro-2,4-difluorophenyl)prop-2-enoic acid. InChIKey: AXQLBJZFLDRWAD-OWOJBTEDSA-N.

Identity
Molecular formulaC9H5ClF2O2
Molecular weight218.58 g/mol
IUPAC name(E)-3-(5-chloro-2,4-difluorophenyl)prop-2-enoic acid
InChIKeyAXQLBJZFLDRWAD-OWOJBTEDSA-N
SMILESC1=C(C(=CC(=C1Cl)F)F)/C=C/C(=O)O

Computed by PubChem (NCBI)