CAS 695187-30-5 is the registry number for 5-Chloro-2,4-difluorocinnamic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
(E)-3-(5-chloro-2,4-difluorophenyl)prop-2-enoic acid (CAS 695187-30-5) is a chemical compound with the molecular formula C9H5ClF2O2 and a molecular weight of 218.58 g/mol. IUPAC name: (E)-3-(5-chloro-2,4-difluorophenyl)prop-2-enoic acid. InChIKey: AXQLBJZFLDRWAD-OWOJBTEDSA-N.
| Molecular formula | C9H5ClF2O2 |
|---|---|
| Molecular weight | 218.58 g/mol |
| IUPAC name | (E)-3-(5-chloro-2,4-difluorophenyl)prop-2-enoic acid |
| InChIKey | AXQLBJZFLDRWAD-OWOJBTEDSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)F)F)/C=C/C(=O)O |
Computed by PubChem (NCBI)