CAS 261762-48-5 is the registry number for 2-Chloro-3,6-difluorocinnamic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
(E)-3-(2-chloro-3,6-difluorophenyl)prop-2-enoic acid (CAS 261762-48-5) is a chemical compound with the molecular formula C9H5ClF2O2 and a molecular weight of 218.58 g/mol. IUPAC name: (E)-3-(2-chloro-3,6-difluorophenyl)prop-2-enoic acid. InChIKey: IHWVLAUNJHXFGN-DAFODLJHSA-N.
| Molecular formula | C9H5ClF2O2 |
|---|---|
| Molecular weight | 218.58 g/mol |
| IUPAC name | (E)-3-(2-chloro-3,6-difluorophenyl)prop-2-enoic acid |
| InChIKey | IHWVLAUNJHXFGN-DAFODLJHSA-N |
| SMILES | C1=CC(=C(C(=C1F)/C=C/C(=O)O)Cl)F |
Computed by PubChem (NCBI)