CAS 116345-96-1 is the registry number for Diacetyl Phloroglucinol. Offered by: TRC. Available pack sizes: 100mg, 250mg, 500mg.
(3-acetyloxy-5-hydroxyphenyl) acetate (CAS 116345-96-1) is a chemical compound with the molecular formula C10H10O5 and a molecular weight of 210.18 g/mol. IUPAC name: (3-acetyloxy-5-hydroxyphenyl) acetate. InChIKey: RIBVPXVGBRGTHR-UHFFFAOYSA-N.
| Molecular formula | C10H10O5 |
|---|---|
| Molecular weight | 210.18 g/mol |
| IUPAC name | (3-acetyloxy-5-hydroxyphenyl) acetate |
| InChIKey | RIBVPXVGBRGTHR-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC(=CC(=C1)O)OC(=O)C |
Computed by PubChem (NCBI)