Products 1164251-94-8
CAS 1164251-94-8 is the registry number for 2-Amino-3-chloro-4,6-dimethoxybenzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-amino-3-chloro-4,6-dimethoxybenzoic acid (CAS 1164251-94-8) is a chemical compound with the molecular formula C9H10ClNO4 and a molecular weight of 231.63 g/mol. IUPAC name: 2-amino-3-chloro-4,6-dimethoxybenzoic acid. InChIKey: YFNWCKDEWLHZNY-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO4 |
|---|---|
| Molecular weight | 231.63 g/mol |
| IUPAC name | 2-amino-3-chloro-4,6-dimethoxybenzoic acid |
| InChIKey | YFNWCKDEWLHZNY-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1C(=O)O)N)Cl)OC |
Computed by PubChem (NCBI)