CAS 116529-23-8 is the registry number for 5-((3-Chloro-2-methylphenyl)amino)-1,3,4-thiadiazole-2-thiol. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
5-(3-chloro-2-methylanilino)-3H-1,3,4-thiadiazole-2-thione (CAS 116529-23-8) is a chemical compound with the molecular formula C9H8ClN3S2 and a molecular weight of 257.8 g/mol. IUPAC name: 5-(3-chloro-2-methylanilino)-3H-1,3,4-thiadiazole-2-thione. InChIKey: GAKFSVUCXVAFRR-UHFFFAOYSA-N.
| Molecular formula | C9H8ClN3S2 |
|---|---|
| Molecular weight | 257.8 g/mol |
| IUPAC name | 5-(3-chloro-2-methylanilino)-3H-1,3,4-thiadiazole-2-thione |
| InChIKey | GAKFSVUCXVAFRR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1Cl)NC2=NNC(=S)S2 |
Computed by PubChem (NCBI)