CAS 731012-13-8 is the registry number for 5-{((2-Chlorophenyl)methyl)sulfanyl}-4H-1,2,4-triazole-3-thiol. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
5-[(2-chlorophenyl)methylsulfanyl]-1,2-dihydro-1,2,4-triazole-3-thione (CAS 731012-13-8) is a chemical compound with the molecular formula C9H8ClN3S2 and a molecular weight of 257.8 g/mol. IUPAC name: 5-[(2-chlorophenyl)methylsulfanyl]-1,2-dihydro-1,2,4-triazole-3-thione. InChIKey: AYLMIXWIPYTMSR-UHFFFAOYSA-N.
| Molecular formula | C9H8ClN3S2 |
|---|---|
| Molecular weight | 257.8 g/mol |
| IUPAC name | 5-[(2-chlorophenyl)methylsulfanyl]-1,2-dihydro-1,2,4-triazole-3-thione |
| InChIKey | AYLMIXWIPYTMSR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CSC2=NC(=S)NN2)Cl |
Computed by PubChem (NCBI)