CAS 447414-55-3 is the registry number for 3-[(2-Chlorobenzyl)thio]-1,2,4-thiadiazol-5-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-[(2-chlorophenyl)methylsulfanyl]-1,2,4-thiadiazol-5-amine (CAS 447414-55-3) is a chemical compound with the molecular formula C9H8ClN3S2 and a molecular weight of 257.8 g/mol. IUPAC name: 3-[(2-chlorophenyl)methylsulfanyl]-1,2,4-thiadiazol-5-amine. InChIKey: YAMYRJAFKHIKNT-UHFFFAOYSA-N.
| Molecular formula | C9H8ClN3S2 |
|---|---|
| Molecular weight | 257.8 g/mol |
| IUPAC name | 3-[(2-chlorophenyl)methylsulfanyl]-1,2,4-thiadiazol-5-amine |
| InChIKey | YAMYRJAFKHIKNT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CSC2=NSC(=N2)N)Cl |
Computed by PubChem (NCBI)