CAS 116529-84-1 appears in our catalog under these names: 6-Methylquinolin-5-ol, 95%, 6–Methylquinolin–5–ol, 6-Methylquinolin-5-ol 95%, 6-Methylquinolin-5-ol, 95%, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 50mg, 1g.
6-methylquinolin-5-ol (CAS 116529-84-1) is a chemical compound with the molecular formula C10H9NO and a molecular weight of 159.18 g/mol. IUPAC name: 6-methylquinolin-5-ol. InChIKey: ZWMNWHYDZZZKPK-UHFFFAOYSA-N.
| Molecular formula | C10H9NO |
|---|---|
| Molecular weight | 159.18 g/mol |
| IUPAC name | 6-methylquinolin-5-ol |
| InChIKey | ZWMNWHYDZZZKPK-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)N=CC=C2)O |
Computed by PubChem (NCBI)