Products 116530-84-8

CAS 116530-84-8 is the registry number for Ethyl 2-(3-methylcyclohexyl)acetate. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

Ethyl 2-(3-methylcyclohexyl)acetate (CAS 116530-84-8) is a chemical compound with the molecular formula C11H20O2 and a molecular weight of 184.27 g/mol. IUPAC name: ethyl 2-(3-methylcyclohexyl)acetate. InChIKey: NPNAIDJBODAJEX-UHFFFAOYSA-N.

Identity
Molecular formulaC11H20O2
Molecular weight184.27 g/mol
IUPAC nameethyl 2-(3-methylcyclohexyl)acetate
InChIKeyNPNAIDJBODAJEX-UHFFFAOYSA-N
SMILESCCOC(=O)CC1CCCC(C1)C

Computed by PubChem (NCBI)