CAS 116593-01-2 appears in our catalog under these names: 3,5-Bis(trifluoromethyl)pyridin-2-amine, 3,5-Bis(trifluoromethyl)pyridin-2-amine, 97%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 1g.
3,5-bis(trifluoromethyl)pyridin-2-amine (CAS 116593-01-2) is a chemical compound with the molecular formula C7H4F6N2 and a molecular weight of 230.11 g/mol. IUPAC name: 3,5-bis(trifluoromethyl)pyridin-2-amine. InChIKey: LNCBHXDODPHVED-UHFFFAOYSA-N.
| Molecular formula | C7H4F6N2 |
|---|---|
| Molecular weight | 230.11 g/mol |
| IUPAC name | 3,5-bis(trifluoromethyl)pyridin-2-amine |
| InChIKey | LNCBHXDODPHVED-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1C(F)(F)F)N)C(F)(F)F |
Computed by PubChem (NCBI)