CAS 78448-45-0 is the registry number for 2,6-Bis(trifluoromethyl)pyridin-4-amine, 95%. Offered by: AmBeed. Available pack sizes: 5g, 10g.
2,6-bis(trifluoromethyl)pyridin-4-amine (CAS 78448-45-0) is a chemical compound with the molecular formula C7H4F6N2 and a molecular weight of 230.11 g/mol. IUPAC name: 2,6-bis(trifluoromethyl)pyridin-4-amine. InChIKey: KPSPGGWCQFNRNP-UHFFFAOYSA-N.
| Molecular formula | C7H4F6N2 |
|---|---|
| Molecular weight | 230.11 g/mol |
| IUPAC name | 2,6-bis(trifluoromethyl)pyridin-4-amine |
| InChIKey | KPSPGGWCQFNRNP-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(N=C1C(F)(F)F)C(F)(F)F)N |
Computed by PubChem (NCBI)